Industry News
Synthesis mechanism of sodium carboxymethyl cellulose
2021-11-06Synthesis mechanism of sodium carboxymethyl cellulose
The alkalization of cellulose to alkali cellulose:
Cell-(OH)3+xNaOH = Cell-(OH)3-x(O-Na+)x+xH2O
The conversion of chloroacetic acid to sodium chloroacetate：
ClCH2COOH +NaOH = ClCH2COONa+H2O
Alkaline cellulose and sodium chloroacetate are converted into：
Cell-(OH)3-x(O-Na+)x +nClCH2COONa = Cell-(OH)3-x (ONa) x-n(OCH2COO-Na+) n + nNaCl
After neutralization and washing：
Cell-(OH)3-x (ONa) x-n(OCH2COO-Na+) n+( x-n)CH3COOH = Cell-(OH)3-n(OCH2COO-Na+) n+( x-n)CH3COONa
